About methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate
methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate (PubChem CID 89464711) has the molecular formula C13H11FO4
and a molecular weight of 250.22 g/mol. Its IUPAC name is methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate.
Molecular Properties
| Compound Name | methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate |
| PubChem CID | 89464711 |
| Molecular Formula | C13H11FO4 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate |
| SMILES | COC(=O)C12CC(=O)OC1c1cc(F)ccc1C2 |
| InChI | InChI=1S/C13H11FO4/c1-17-12(16)13-5-7-2-3-8(14)4-9(7)11(13)18-10(15)6-13/h2-4,11H,5-6H2,1H3 |
| InChIKey | CPWVRHFSWOYIDH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate?
The IUPAC name of methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate (CID 89464711) is methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate.
What is the SMILES notation for methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate?
The canonical SMILES for methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate is COC(=O)C12CC(=O)OC1c1cc(F)ccc1C2.
What is the InChIKey of methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate?
The InChIKey is CPWVRHFSWOYIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FO4/c1-17-12(16)13-5-7-2-3-8(14)4-9(7)11(13)18-10(15)6-13/h2-4,11H,5-6H2,1H3.
What are the key properties of methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate?
methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate has a molecular weight of 250.22 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-fluoro-2-oxo-4,8b-dihydro-3H-indeno[1,2-b]furan-3a-carboxylate is sourced from PubChem (CID 89464711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).