About 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde
1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 89465603) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde.
Molecular Properties
| Compound Name | 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde |
| PubChem CID | 89465603 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | O=CN1CCC2(CC1)CNCCO2 |
| InChI | InChI=1S/C9H16N2O2/c12-8-11-4-1-9(2-5-11)7-10-3-6-13-9/h8,10H,1-7H2 |
| InChIKey | OQAHWTMKJTWALS-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde?
The IUPAC name of 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde (CID 89465603) is 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde.
What is the SMILES notation for 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde?
The canonical SMILES for 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde is O=CN1CCC2(CC1)CNCCO2.
What is the InChIKey of 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde?
The InChIKey is OQAHWTMKJTWALS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c12-8-11-4-1-9(2-5-11)7-10-3-6-13-9/h8,10H,1-7H2.
What are the key properties of 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde?
1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde has a molecular weight of 184.24 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-4,9-diazaspiro[5.5]undecane-9-carbaldehyde is sourced from PubChem (CID 89465603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).