C30H30N4OS — CID 89467143
N-butyl-1-[3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indol-6-yl]ethanimine (PubChem CID 89467143) has the molecular formula C30H30N4OS and a molecular weight of 494.66 g/mol. Its IUPAC name is N-butyl-1-[3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indol-6-yl]ethanimine.
| Compound Name | N-butyl-1-[3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indol-6-yl]ethanimine |
|---|---|
| PubChem CID | 89467143 |
| Molecular Formula | C30H30N4OS |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-butyl-1-[3-[5-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indol-6-yl]ethanimine |
| SMILES | CCCC/N=C(\C)c1ccc2c(-c3ccc(-c4cc5ccc(C6=NCCCN6)cc5o4)s3)c[nH]c2c1 |
| InChI | InChI=1S/C30H30N4OS/c1-3-4-12-31-19(2)20-8-9-23-24(18-34-25(23)15-20)28-10-11-29(36-28)27-16-21-6-7-22(17-26(21)35-27)30-32-13-5-14-33-30/h6-11,15-18,34H,3-5,12-14H2,1-2H3,(H,32,33)/b31-19+ |
| InChIKey | ZMNMJNJXVZQRDO-ZCTHSVRISA-N |
| XLogP | 7.66 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|