About (5R)-2,5-dimethylcyclohex-2-en-1-one
(5R)-2,5-dimethylcyclohex-2-en-1-one (PubChem CID 89467167) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (5R)-2,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (5R)-2,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 89467167 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (5R)-2,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC[C@@H](C)CC1=O |
| InChI | InChI=1S/C8H12O/c1-6-3-4-7(2)8(9)5-6/h4,6H,3,5H2,1-2H3/t6-/m1/s1 |
| InChIKey | DOHDEMCKFSQGLE-ZCFIWIBFSA-N |
| XLogP | 1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R)-2,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of (5R)-2,5-dimethylcyclohex-2-en-1-one (CID 89467167) is (5R)-2,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for (5R)-2,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for (5R)-2,5-dimethylcyclohex-2-en-1-one is CC1=CC[C@@H](C)CC1=O.
What is the InChIKey of (5R)-2,5-dimethylcyclohex-2-en-1-one?
The InChIKey is DOHDEMCKFSQGLE-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H12O/c1-6-3-4-7(2)8(9)5-6/h4,6H,3,5H2,1-2H3/t6-/m1/s1.
What are the key properties of (5R)-2,5-dimethylcyclohex-2-en-1-one?
(5R)-2,5-dimethylcyclohex-2-en-1-one has a molecular weight of 124.18 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 89467167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).