C14H28N2O3Si — CID 89467233
2-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-dimethylsilyl]ethanol (PubChem CID 89467233) has the molecular formula C14H28N2O3Si and a molecular weight of 300.48 g/mol. Its IUPAC name is 2-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-dimethylsilyl]ethanol.
| Compound Name | 2-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-dimethylsilyl]ethanol |
|---|---|
| PubChem CID | 89467233 |
| Molecular Formula | C14H28N2O3Si |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl-dimethylsilyl]ethanol |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1C[Si](C)(C)CCO |
| InChI | InChI=1S/C14H28N2O3Si/c1-10(2)12-14(19-4)15-11(13(16-12)18-3)9-20(5,6)8-7-17/h10-12,17H,7-9H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | GIVRINIYPZRRKU-NWDGAFQWSA-N |
| XLogP | 2.18 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|