C14H27ClN2O2Si — CID 89467236
2-chloroethyl-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane (PubChem CID 89467236) has the molecular formula C14H27ClN2O2Si and a molecular weight of 318.92 g/mol. Its IUPAC name is 2-chloroethyl-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane.
| Compound Name | 2-chloroethyl-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 89467236 |
| Molecular Formula | C14H27ClN2O2Si |
| Molecular Weight | 318.92 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-chloroethyl-[[(2R,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@H]1C[Si](C)(C)CCCl |
| InChI | InChI=1S/C14H27ClN2O2Si/c1-10(2)12-14(19-4)16-11(13(17-12)18-3)9-20(5,6)8-7-15/h10-12H,7-9H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | XGENROBPVDQYLB-NWDGAFQWSA-N |
| XLogP | 3.43 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.92 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|