About 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol
1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol (PubChem CID 89467563) has the molecular formula C11H22F3NO2
and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol |
| PubChem CID | 89467563 |
| Molecular Formula | C11H22F3NO2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol |
| SMILES | CCN(CC)CC(O)COCC(F)(F)C(C)F |
| InChI | InChI=1S/C11H22F3NO2/c1-4-15(5-2)6-10(16)7-17-8-11(13,14)9(3)12/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | KTJGIPVYLPEMIA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol?
The IUPAC name of 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol (CID 89467563) is 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol.
What is the SMILES notation for 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol?
The canonical SMILES for 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol is CCN(CC)CC(O)COCC(F)(F)C(C)F.
What is the InChIKey of 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol?
The InChIKey is KTJGIPVYLPEMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3NO2/c1-4-15(5-2)6-10(16)7-17-8-11(13,14)9(3)12/h9-10,16H,4-8H2,1-3H3.
What are the key properties of 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol?
1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol has a molecular weight of 257.30 g/mol, XLogP of 1.70, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)-3-(2,2,3-trifluorobutoxy)propan-2-ol is sourced from PubChem (CID 89467563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).