C19H32N4O6 — CID 89467799
(E)-N-(6-aminohexyl)-3-[1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxyethyl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide (PubChem CID 89467799) has the molecular formula C19H32N4O6 and a molecular weight of 412.49 g/mol. Its IUPAC name is (E)-N-(6-aminohexyl)-3-[1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxyethyl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide.
| Compound Name | (E)-N-(6-aminohexyl)-3-[1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxyethyl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89467799 |
| Molecular Formula | C19H32N4O6 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (E)-N-(6-aminohexyl)-3-[1-[(1R)-1-[(2R,3R)-1,3-dihydroxybutan-2-yl]oxyethyl]-2,4-dioxopyrimidin-5-yl]prop-2-enamide |
| SMILES | C[C@@H](O)[C@@H](CO)O[C@H](C)n1cc(/C=C/C(=O)NCCCCCCN)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H32N4O6/c1-13(25)16(12-24)29-14(2)23-11-15(18(27)22-19(23)28)7-8-17(26)21-10-6-4-3-5-9-20/h7-8,11,13-14,16,24-25H,3-6,9-10,12,20H2,1-2H3,(H,21,26)(H,22,27,28)/b8-7+/t13-,14-,16-/m1/s1 |
| InChIKey | CGLPDJXCYUTIJO-LDPPUTLGSA-N |
| XLogP | -0.54 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|