C22H29N3O5Si — CID 89467995
(3S,5S,6S)-5-azido-6-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 89467995) has the molecular formula C22H29N3O5Si and a molecular weight of 443.58 g/mol. Its IUPAC name is (3S,5S,6S)-5-azido-6-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3S,5S,6S)-5-azido-6-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 89467995 |
| Molecular Formula | C22H29N3O5Si |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (3S,5S,6S)-5-azido-6-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C[C@@H]1OC(CO)[C@@H](O)C(O)[C@@H]1N=[N+]=[N-])[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O5Si/c1-22(2,13-17-19(24-25-23)21(28)20(27)18(14-26)30-17)31(29,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-21,26-29H,13-14H2,1-2H3/t17-,18?,19+,20+,21?/m0/s1 |
| InChIKey | XDTADBWIDHDBJZ-VPRPLRRXSA-N |
| XLogP | 1.07 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|