C31H47N3O4SSi — CID 89468072
[4-[(3R,5S,6S)-5-azido-3,4-dibutoxy-6-methylsulfanyloxan-2-yl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane (PubChem CID 89468072) has the molecular formula C31H47N3O4SSi and a molecular weight of 585.89 g/mol. Its IUPAC name is [4-[(3R,5S,6S)-5-azido-3,4-dibutoxy-6-methylsulfanyloxan-2-yl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane.
| Compound Name | [4-[(3R,5S,6S)-5-azido-3,4-dibutoxy-6-methylsulfanyloxan-2-yl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 89468072 |
| Molecular Formula | C31H47N3O4SSi |
| Molecular Weight | 585.89 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | [4-[(3R,5S,6S)-5-azido-3,4-dibutoxy-6-methylsulfanyloxan-2-yl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane |
| SMILES | CCCCOC1[C@H](OCCCC)C(CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O[C@@H](SC)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C31H47N3O4SSi/c1-6-8-22-36-28-26(38-30(39-5)27(33-34-32)29(28)37-23-9-7-2)20-21-31(3,4)40(35,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,26-30,35H,6-9,20-23H2,1-5H3/t26?,27-,28+,29?,30-/m0/s1 |
| InChIKey | WVBXVNROEKQTMB-OEJXXSPASA-N |
| XLogP | 6.44 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.89 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|