About 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine
5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine (PubChem CID 89468087) has the molecular formula C19H15ClN2
and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine.
Molecular Properties
| Compound Name | 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine |
| PubChem CID | 89468087 |
| Molecular Formula | C19H15ClN2 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine |
| SMILES | C=C/C(=C\C)c1nc2ccnc(Cl)c2cc1-c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2/c1-3-13(4-2)18-15(14-8-6-5-7-9-14)12-16-17(22-18)10-11-21-19(16)20/h3-12H,1H2,2H3/b13-4+ |
| InChIKey | KKUNNKONZRWRNW-YIXHJXPBSA-N |
| XLogP | 5.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine?
The IUPAC name of 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine (CID 89468087) is 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine.
What is the SMILES notation for 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine?
The canonical SMILES for 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine is C=C/C(=C\C)c1nc2ccnc(Cl)c2cc1-c1ccccc1.
What is the InChIKey of 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine?
The InChIKey is KKUNNKONZRWRNW-YIXHJXPBSA-N. The full InChI is InChI=1S/C19H15ClN2/c1-3-13(4-2)18-15(14-8-6-5-7-9-14)12-16-17(22-18)10-11-21-19(16)20/h3-12H,1H2,2H3/b13-4+.
What are the key properties of 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine?
5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine has a molecular weight of 306.80 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3E)-penta-1,3-dien-3-yl]-3-phenyl-1,6-naphthyridine is sourced from PubChem (CID 89468087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).