C8H14N4 — CID 89468106
(1Z,3Z)-6-(2-aminohydrazinyl)-5-methylidenehepta-1,3,6-trien-1-amine (PubChem CID 89468106) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is (1Z,3Z)-6-(2-aminohydrazinyl)-5-methylidenehepta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3Z)-6-(2-aminohydrazinyl)-5-methylidenehepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 89468106 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (1Z,3Z)-6-(2-aminohydrazinyl)-5-methylidenehepta-1,3,6-trien-1-amine |
| SMILES | C=C(/C=C\C=C/N)C(=C)NNN |
| InChI | InChI=1S/C8H14N4/c1-7(5-3-4-6-9)8(2)11-12-10/h3-6,11-12H,1-2,9-10H2/b5-3-,6-4- |
| InChIKey | OITMXVIGSMATSQ-GLIMQPGKSA-N |
| XLogP | 0.05 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|