C7H8N2OS — CID 89468133
5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbaldehyde (PubChem CID 89468133) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbaldehyde.
| Compound Name | 5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 89468133 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbaldehyde |
| SMILES | CN1Cc2nc(C=O)sc2C1 |
| InChI | InChI=1S/C7H8N2OS/c1-9-2-5-6(3-9)11-7(4-10)8-5/h4H,2-3H2,1H3 |
| InChIKey | PAGKXDSDIQKMSU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|