About 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine
2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine (PubChem CID 89468390) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine |
| PubChem CID | 89468390 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine |
| SMILES | CNc1nc(Cl)nc2c1=CCCC=2 |
| InChI | InChI=1S/C9H10ClN3/c1-11-8-6-4-2-3-5-7(6)12-9(10)13-8/h4-5H,2-3H2,1H3,(H,11,12,13) |
| InChIKey | SDGJDCHMNPLTPT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine?
The IUPAC name of 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine (CID 89468390) is 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine.
What is the SMILES notation for 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine?
The canonical SMILES for 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine is CNc1nc(Cl)nc2c1=CCCC=2.
What is the InChIKey of 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine?
The InChIKey is SDGJDCHMNPLTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3/c1-11-8-6-4-2-3-5-7(6)12-9(10)13-8/h4-5H,2-3H2,1H3,(H,11,12,13).
What are the key properties of 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine?
2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine has a molecular weight of 195.65 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methyl-6,7-dihydroquinazolin-4-amine is sourced from PubChem (CID 89468390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).