About 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione
4-amino-4a,8a-dihydro-1H-quinazoline-2-thione (PubChem CID 89468491) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione.
Molecular Properties
| Compound Name | 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione |
| PubChem CID | 89468491 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione |
| SMILES | NC1=NC(=S)NC2C=CC=CC12 |
| InChI | InChI=1S/C8H9N3S/c9-7-5-3-1-2-4-6(5)10-8(12)11-7/h1-6H,(H3,9,10,11,12) |
| InChIKey | CDNWQBLQLVTHOQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione?
The IUPAC name of 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione (CID 89468491) is 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione.
What is the SMILES notation for 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione?
The canonical SMILES for 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione is NC1=NC(=S)NC2C=CC=CC12.
What is the InChIKey of 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione?
The InChIKey is CDNWQBLQLVTHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c9-7-5-3-1-2-4-6(5)10-8(12)11-7/h1-6H,(H3,9,10,11,12).
What are the key properties of 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione?
4-amino-4a,8a-dihydro-1H-quinazoline-2-thione has a molecular weight of 179.25 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4a,8a-dihydro-1H-quinazoline-2-thione is sourced from PubChem (CID 89468491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).