About 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene
5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene (PubChem CID 89468858) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene.
Molecular Properties
| Compound Name | 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene |
| PubChem CID | 89468858 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene |
| SMILES | C/C=C(/C(C)C)N1CCOC2=C=C21 |
| InChI | InChI=1S/C11H15NO/c1-4-9(8(2)3)12-5-6-13-11-7-10(11)12/h4,8H,5-6H2,1-3H3/b9-4- |
| InChIKey | SNGHLPZMTXUMSF-WTKPLQERSA-N |
| XLogP | 2.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene?
The IUPAC name of 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene (CID 89468858) is 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene.
What is the SMILES notation for 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene?
The canonical SMILES for 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene is C/C=C(/C(C)C)N1CCOC2=C=C21.
What is the InChIKey of 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene?
The InChIKey is SNGHLPZMTXUMSF-WTKPLQERSA-N. The full InChI is InChI=1S/C11H15NO/c1-4-9(8(2)3)12-5-6-13-11-7-10(11)12/h4,8H,5-6H2,1-3H3/b9-4-.
What are the key properties of 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene?
5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene has a molecular weight of 177.25 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-4-methylpent-2-en-3-yl]-2-oxa-5-azabicyclo[4.1.0]hepta-1(7),6-diene is sourced from PubChem (CID 89468858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).