About 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one
1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one (PubChem CID 89468908) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one |
| PubChem CID | 89468908 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one |
| SMILES | C=C/C=C\C1=C(C)CCN1C(=O)C(C)C |
| InChI | InChI=1S/C13H19NO/c1-5-6-7-12-11(4)8-9-14(12)13(15)10(2)3/h5-7,10H,1,8-9H2,2-4H3/b7-6- |
| InChIKey | QGQFPMVIZBWLRU-SREVYHEPSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one?
The IUPAC name of 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one (CID 89468908) is 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one?
The canonical SMILES for 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one is C=C/C=C\C1=C(C)CCN1C(=O)C(C)C.
What is the InChIKey of 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one?
The InChIKey is QGQFPMVIZBWLRU-SREVYHEPSA-N. The full InChI is InChI=1S/C13H19NO/c1-5-6-7-12-11(4)8-9-14(12)13(15)10(2)3/h5-7,10H,1,8-9H2,2-4H3/b7-6-.
What are the key properties of 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one?
1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one has a molecular weight of 205.30 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydropyrrol-1-yl]-2-methylpropan-1-one is sourced from PubChem (CID 89468908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).