About (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol
(1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol (PubChem CID 89469338) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol |
| PubChem CID | 89469338 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol |
| SMILES | C=C/C(=C\C)C1=C[C@H](S)C(N)C=C1 |
| InChI | InChI=1S/C11H15NS/c1-3-8(4-2)9-5-6-10(12)11(13)7-9/h3-7,10-11,13H,1,12H2,2H3/b8-4+/t10?,11-/m0/s1 |
| InChIKey | OHNIXXGZRGKABN-OLWBWNHRSA-N |
| XLogP | 2.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol?
The IUPAC name of (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol (CID 89469338) is (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol?
The canonical SMILES for (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol is C=C/C(=C\C)C1=C[C@H](S)C(N)C=C1.
What is the InChIKey of (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol?
The InChIKey is OHNIXXGZRGKABN-OLWBWNHRSA-N. The full InChI is InChI=1S/C11H15NS/c1-3-8(4-2)9-5-6-10(12)11(13)7-9/h3-7,10-11,13H,1,12H2,2H3/b8-4+/t10?,11-/m0/s1.
What are the key properties of (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol?
(1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol has a molecular weight of 193.31 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-6-amino-3-[(3E)-penta-1,3-dien-3-yl]cyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 89469338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).