About (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate
(1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate (PubChem CID 89469505) has the molecular formula C21H21N5O2S
and a molecular weight of 407.50 g/mol. Its IUPAC name is (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate.
Molecular Properties
| Compound Name | (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
| PubChem CID | 89469505 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
| SMILES | Cc1ccc(-c2nc(C)c(NC(=O)OCc3ccc4c(c3)nnn4C)s2)c(C)c1 |
| InChI | InChI=1S/C21H21N5O2S/c1-12-5-7-16(13(2)9-12)20-22-14(3)19(29-20)23-21(27)28-11-15-6-8-18-17(10-15)24-25-26(18)4/h5-10H,11H2,1-4H3,(H,23,27) |
| InChIKey | ILGOYPBDVFLSDW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
The IUPAC name of (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate (CID 89469505) is (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate.
What is the SMILES notation for (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
The canonical SMILES for (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate is Cc1ccc(-c2nc(C)c(NC(=O)OCc3ccc4c(c3)nnn4C)s2)c(C)c1.
What is the InChIKey of (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
The InChIKey is ILGOYPBDVFLSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O2S/c1-12-5-7-16(13(2)9-12)20-22-14(3)19(29-20)23-21(27)28-11-15-6-8-18-17(10-15)24-25-26(18)4/h5-10H,11H2,1-4H3,(H,23,27).
What are the key properties of (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate?
(1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate has a molecular weight of 407.50 g/mol, XLogP of 4.77, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylbenzotriazol-5-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate is sourced from PubChem (CID 89469505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).