About (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate
(1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate (PubChem CID 89469698) has the molecular formula C22H21N5O2
and a molecular weight of 387.44 g/mol. Its IUPAC name is (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate.
Molecular Properties
| Compound Name | (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate |
| PubChem CID | 89469698 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate |
| SMILES | Cc1nc2cc(COC(=O)Nc3c4c(nn3C)-c3ccccc3C4)ccc2n1C |
| InChI | InChI=1S/C22H21N5O2/c1-13-23-18-10-14(8-9-19(18)26(13)2)12-29-22(28)24-21-17-11-15-6-4-5-7-16(15)20(17)25-27(21)3/h4-10H,11-12H2,1-3H3,(H,24,28) |
| InChIKey | UJUXYSOSYOMKGX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate?
The IUPAC name of (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate (CID 89469698) is (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate.
What is the SMILES notation for (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate?
The canonical SMILES for (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate is Cc1nc2cc(COC(=O)Nc3c4c(nn3C)-c3ccccc3C4)ccc2n1C.
What is the InChIKey of (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate?
The InChIKey is UJUXYSOSYOMKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5O2/c1-13-23-18-10-14(8-9-19(18)26(13)2)12-29-22(28)24-21-17-11-15-6-4-5-7-16(15)20(17)25-27(21)3/h4-10H,11-12H2,1-3H3,(H,24,28).
What are the key properties of (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate?
(1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate has a molecular weight of 387.44 g/mol, XLogP of 3.94, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylbenzimidazol-5-yl)methyl N-(2-methyl-4H-indeno[1,2-c]pyrazol-3-yl)carbamate is sourced from PubChem (CID 89469698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).