About (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate
(1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate (PubChem CID 89469741) has the molecular formula C23H23FN4O3S
and a molecular weight of 454.53 g/mol. Its IUPAC name is (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate.
Molecular Properties
| Compound Name | (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate |
| PubChem CID | 89469741 |
| Molecular Formula | C23H23FN4O3S |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate |
| SMILES | CCc1nc(-c2ccc(F)cc2OC)sc1NC(=O)OCc1ccc2c(cnn2CC)c1 |
| InChI | InChI=1S/C23H23FN4O3S/c1-4-18-22(32-21(26-18)17-8-7-16(24)11-20(17)30-3)27-23(29)31-13-14-6-9-19-15(10-14)12-25-28(19)5-2/h6-12H,4-5,13H2,1-3H3,(H,27,29) |
| InChIKey | AUUWZWGJVMNFFS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate?
The IUPAC name of (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate (CID 89469741) is (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate.
What is the SMILES notation for (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate?
The canonical SMILES for (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate is CCc1nc(-c2ccc(F)cc2OC)sc1NC(=O)OCc1ccc2c(cnn2CC)c1.
What is the InChIKey of (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate?
The InChIKey is AUUWZWGJVMNFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN4O3S/c1-4-18-22(32-21(26-18)17-8-7-16(24)11-20(17)30-3)27-23(29)31-13-14-6-9-19-15(10-14)12-25-28(19)5-2/h6-12H,4-5,13H2,1-3H3,(H,27,29).
What are the key properties of (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate?
(1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate has a molecular weight of 454.53 g/mol, XLogP of 5.64, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylindazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methoxyphenyl)-1,3-thiazol-5-yl]carbamate is sourced from PubChem (CID 89469741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).