C22H20ClN3O3S — CID 89469810
2-(4-chloro-2-methoxyphenyl)-N-[(E)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 89469810) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxyphenyl)-N-[(E)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-chloro-2-methoxyphenyl)-N-[(E)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 89469810 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-(4-chloro-2-methoxyphenyl)-N-[(E)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc2c(c1)CC/C2=N\NC(=O)c1sc(-c2ccc(Cl)cc2OC)nc1C |
| InChI | InChI=1S/C22H20ClN3O3S/c1-12-20(30-22(24-12)17-7-5-14(23)11-19(17)29-3)21(27)26-25-18-9-4-13-10-15(28-2)6-8-16(13)18/h5-8,10-11H,4,9H2,1-3H3,(H,26,27)/b25-18+ |
| InChIKey | NPABSECECSEFRK-XIEYBQDHSA-N |
| XLogP | 4.87 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|