C14H22N2O — CID 89470017
2-methyl-5-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3,4-oxadiazole (PubChem CID 89470017) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-methyl-5-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 89470017 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-methyl-5-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3,4-oxadiazole |
| SMILES | Cc1nnc(C2CCC3CC(C)CCC3C2)o1 |
| InChI | InChI=1S/C14H22N2O/c1-9-3-4-12-8-13(6-5-11(12)7-9)14-16-15-10(2)17-14/h9,11-13H,3-8H2,1-2H3 |
| InChIKey | CBFPFYVIPQSVEF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |