C9H13N — CID 89470665
(1Z,3Z,6E)-5-methylideneocta-1,3,6-trien-1-amine (PubChem CID 89470665) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (1Z,3Z,6E)-5-methylideneocta-1,3,6-trien-1-amine.
| Compound Name | (1Z,3Z,6E)-5-methylideneocta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 89470665 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (1Z,3Z,6E)-5-methylideneocta-1,3,6-trien-1-amine |
| SMILES | C=C(/C=C\C=C/N)/C=C/C |
| InChI | InChI=1S/C9H13N/c1-3-6-9(2)7-4-5-8-10/h3-8H,2,10H2,1H3/b6-3+,7-4-,8-5- |
| InChIKey | GMJQYTHMZRSASR-YFKOXLSJSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|