C14H18N2O7S — CID 8947088
(2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxy-5-nitrophenoxy)propanamide (PubChem CID 8947088) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxy-5-nitrophenoxy)propanamide.
| Compound Name | (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxy-5-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 8947088 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(2-methoxy-5-nitrophenoxy)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1O[C@@H](C)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18N2O7S/c1-9(14(17)15-10-5-6-24(20,21)8-10)23-13-7-11(16(18)19)3-4-12(13)22-2/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,15,17)/t9-,10-/m0/s1 |
| InChIKey | SWFGWHPBUGHJQI-UWVGGRQHSA-N |
| XLogP | 0.67 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|