About 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide
3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide (PubChem CID 89471082) has the molecular formula C17H19N5O
and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide |
| PubChem CID | 89471082 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide |
| SMILES | N#C[C@H]1CCCC[C@@H]1n1cc(C(N)=O)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H19N5O/c18-10-12-6-4-5-9-15(12)22-11-14(16(19)23)17(21-22)20-13-7-2-1-3-8-13/h1-3,7-8,11-12,15H,4-6,9H2,(H2,19,23)(H,20,21)/t12-,15+/m1/s1 |
| InChIKey | DLZJFUWJIGTHDZ-DOMZBBRYSA-N |
| XLogP | 2.98 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide?
The IUPAC name of 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide (CID 89471082) is 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide.
What is the SMILES notation for 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide?
The canonical SMILES for 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide is N#C[C@H]1CCCC[C@@H]1n1cc(C(N)=O)c(Nc2ccccc2)n1.
What is the InChIKey of 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide?
The InChIKey is DLZJFUWJIGTHDZ-DOMZBBRYSA-N. The full InChI is InChI=1S/C17H19N5O/c18-10-12-6-4-5-9-15(12)22-11-14(16(19)23)17(21-22)20-13-7-2-1-3-8-13/h1-3,7-8,11-12,15H,4-6,9H2,(H2,19,23)(H,20,21)/t12-,15+/m1/s1.
What are the key properties of 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide?
3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide has a molecular weight of 309.37 g/mol, XLogP of 2.98, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-1-[(1S,2S)-2-cyanocyclohexyl]pyrazole-4-carboxamide is sourced from PubChem (CID 89471082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).