C17H24BNO4 — CID 89471908
1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-one (PubChem CID 89471908) has the molecular formula C17H24BNO4 and a molecular weight of 317.19 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-one.
| Compound Name | 1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-one |
|---|---|
| PubChem CID | 89471908 |
| Molecular Formula | C17H24BNO4 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-one |
| SMILES | COCCN1C(=O)Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C17H24BNO4/c1-16(2)17(3,4)23-18(22-16)13-7-6-12-10-15(20)19(8-9-21-5)14(12)11-13/h6-7,11H,8-10H2,1-5H3 |
| InChIKey | CMJSRSCKIJVDDL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|