C19H25F2N — CID 89472435
(3Z,5Z)-1-(2,4-difluoro-6-methylphenyl)-N-(2-methylbutan-2-yl)hepta-3,5-dien-2-imine (PubChem CID 89472435) has the molecular formula C19H25F2N and a molecular weight of 305.41 g/mol. Its IUPAC name is (3Z,5Z)-1-(2,4-difluoro-6-methylphenyl)-N-(2-methylbutan-2-yl)hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-1-(2,4-difluoro-6-methylphenyl)-N-(2-methylbutan-2-yl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 89472435 |
| Molecular Formula | C19H25F2N |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (3Z,5Z)-1-(2,4-difluoro-6-methylphenyl)-N-(2-methylbutan-2-yl)hepta-3,5-dien-2-imine |
| SMILES | C/C=C\C=C/C(Cc1c(C)cc(F)cc1F)=N\C(C)(C)CC |
| InChI | InChI=1S/C19H25F2N/c1-6-8-9-10-16(22-19(4,5)7-2)13-17-14(3)11-15(20)12-18(17)21/h6,8-12H,7,13H2,1-5H3/b8-6-,10-9-,22-16+ |
| InChIKey | FYJNHQMSGNOWRC-WTYRTUIHSA-N |
| XLogP | 5.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|