C17H28OSi — CID 89472488
tert-butyl-[(1S,5R)-3-ethynyl-2,5-dimethyl-6-methylidenecyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 89472488) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is tert-butyl-[(1S,5R)-3-ethynyl-2,5-dimethyl-6-methylidenecyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,5R)-3-ethynyl-2,5-dimethyl-6-methylidenecyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89472488 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | tert-butyl-[(1S,5R)-3-ethynyl-2,5-dimethyl-6-methylidenecyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C#CC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=C)[C@H](C)C1 |
| InChI | InChI=1S/C17H28OSi/c1-10-15-11-12(2)13(3)16(14(15)4)18-19(8,9)17(5,6)7/h1,12,16H,3,11H2,2,4-9H3/t12-,16+/m1/s1 |
| InChIKey | VBSSJPAKOMESGS-WBMJQRKESA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|