C17H17BrN2O5 — CID 8947249
(2R)-N-(2-bromo-4-methylphenyl)-2-(2-methoxy-5-nitrophenoxy)propanamide (PubChem CID 8947249) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is (2R)-N-(2-bromo-4-methylphenyl)-2-(2-methoxy-5-nitrophenoxy)propanamide.
| Compound Name | (2R)-N-(2-bromo-4-methylphenyl)-2-(2-methoxy-5-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 8947249 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | (2R)-N-(2-bromo-4-methylphenyl)-2-(2-methoxy-5-nitrophenoxy)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1O[C@H](C)C(=O)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C17H17BrN2O5/c1-10-4-6-14(13(18)8-10)19-17(21)11(2)25-16-9-12(20(22)23)5-7-15(16)24-3/h4-9,11H,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | DXHXFZMKVNKTLG-LLVKDONJSA-N |
| XLogP | 4.08 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|