C17H30O3Si — CID 89472490
methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-4-methylidenecyclohexene-1-carboxylate (PubChem CID 89472490) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-4-methylidenecyclohexene-1-carboxylate.
| Compound Name | methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-4-methylidenecyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 89472490 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethyl-4-methylidenecyclohexene-1-carboxylate |
| SMILES | C=C1[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C(C(=O)OC)C[C@H]1C |
| InChI | InChI=1S/C17H30O3Si/c1-11-10-14(16(18)19-7)13(3)15(12(11)2)20-21(8,9)17(4,5)6/h11,15H,2,10H2,1,3-9H3/t11-,15+/m1/s1 |
| InChIKey | HVGIGDJEFYQUQX-ABAIWWIYSA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|