C38H57F3O2S — CID 89473042
(5S,17S)-3-(2,2-dimethylbutoxy)-11-(4-ethylsulfanylphenyl)-3,5,13-trimethyl-17-(2,3,3-trifluorobutan-2-yl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 89473042) has the molecular formula C38H57F3O2S and a molecular weight of 634.93 g/mol. Its IUPAC name is (5S,17S)-3-(2,2-dimethylbutoxy)-11-(4-ethylsulfanylphenyl)-3,5,13-trimethyl-17-(2,3,3-trifluorobutan-2-yl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (5S,17S)-3-(2,2-dimethylbutoxy)-11-(4-ethylsulfanylphenyl)-3,5,13-trimethyl-17-(2,3,3-trifluorobutan-2-yl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 89473042 |
| Molecular Formula | C38H57F3O2S |
| Molecular Weight | 634.93 g/mol |
| Exact Mass | 634.40 |
| IUPAC Name | (5S,17S)-3-(2,2-dimethylbutoxy)-11-(4-ethylsulfanylphenyl)-3,5,13-trimethyl-17-(2,3,3-trifluorobutan-2-yl)-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CCSc1ccc(C2CC3(C)C(CC[C@@]3(O)C(C)(F)C(C)(F)F)C3CC[C@@]4(C)CC(C)(OCC(C)(C)CC)CCC4=C23)cc1 |
| InChI | InChI=1S/C38H57F3O2S/c1-10-32(3,4)24-43-34(6)20-17-30-31-27(16-19-33(30,5)23-34)29-18-21-38(42,36(8,39)37(9,40)41)35(29,7)22-28(31)25-12-14-26(15-13-25)44-11-2/h12-15,27-29,42H,10-11,16-24H2,1-9H3/t27?,28?,29?,33-,34?,35?,36?,38-/m0/s1 |
| InChIKey | BSOXDUIWFLJGNG-LGIAHGJWSA-N |
| XLogP | 10.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.93 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|