C30H36F4O4S — CID 89473045
(13S,17S)-11-(4-ethylsulfonylphenyl)-17-methoxy-13-methyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 89473045) has the molecular formula C30H36F4O4S and a molecular weight of 568.67 g/mol. Its IUPAC name is (13S,17S)-11-(4-ethylsulfonylphenyl)-17-methoxy-13-methyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (13S,17S)-11-(4-ethylsulfonylphenyl)-17-methoxy-13-methyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 89473045 |
| Molecular Formula | C30H36F4O4S |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (13S,17S)-11-(4-ethylsulfonylphenyl)-17-methoxy-13-methyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCS(=O)(=O)c1ccc(C2C[C@@]3(C)C(CC[C@@]3(OC)C(F)(F)C(C)(F)F)C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C30H36F4O4S/c1-5-39(36,37)21-10-6-18(7-11-21)24-17-27(2)25(14-15-29(27,38-4)30(33,34)28(3,31)32)23-12-8-19-16-20(35)9-13-22(19)26(23)24/h6-7,10-11,16,23-25H,5,8-9,12-15,17H2,1-4H3/t23?,24?,25?,27-,29-/m0/s1 |
| InChIKey | XBXCDMZQSIUJDS-BVKLZXPISA-N |
| XLogP | 7.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|