About 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole
2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole (PubChem CID 89473180) has the molecular formula C7H7NS3
and a molecular weight of 201.34 g/mol. Its IUPAC name is 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole |
| PubChem CID | 89473180 |
| Molecular Formula | C7H7NS3 |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole |
| SMILES | SSC1=NC2C=CC=CC2S1 |
| InChI | InChI=1S/C7H7NS3/c9-11-7-8-5-3-1-2-4-6(5)10-7/h1-6,9H |
| InChIKey | RPOICHWCXNCTOK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole?
The IUPAC name of 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole (CID 89473180) is 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole.
What is the SMILES notation for 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole?
The canonical SMILES for 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole is SSC1=NC2C=CC=CC2S1.
What is the InChIKey of 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole?
The InChIKey is RPOICHWCXNCTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS3/c9-11-7-8-5-3-1-2-4-6(5)10-7/h1-6,9H.
What are the key properties of 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole?
2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole has a molecular weight of 201.34 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(disulfanyl)-3a,7a-dihydro-1,3-benzothiazole is sourced from PubChem (CID 89473180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).