C14H20N2 — CID 89473276
1-N-[(2E,4Z)-3-methylnona-2,4-dien-2-yl]but-3-yne-1,2-diimine (PubChem CID 89473276) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-N-[(2E,4Z)-3-methylnona-2,4-dien-2-yl]but-3-yne-1,2-diimine.
| Compound Name | 1-N-[(2E,4Z)-3-methylnona-2,4-dien-2-yl]but-3-yne-1,2-diimine |
|---|---|
| PubChem CID | 89473276 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-N-[(2E,4Z)-3-methylnona-2,4-dien-2-yl]but-3-yne-1,2-diimine |
| SMILES | [H]/N=C(C#C)/C=N/C(C)=C(C)/C=C\CCCC |
| InChI | InChI=1S/C14H20N2/c1-5-7-8-9-10-12(3)13(4)16-11-14(15)6-2/h2,9-11,15H,5,7-8H2,1,3-4H3/b10-9-,13-12+,15-14+,16-11+ |
| InChIKey | YRPXBQOEHYXIDP-YBHXKAMCSA-N |
| XLogP | 3.75 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|