C12H17F2N3O — CID 89473328
4-[(1E,3E)-5,5-difluoro-4-methanimidoylpenta-1,3-dienyl]-1,4-diazepane-1-carbaldehyde (PubChem CID 89473328) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 4-[(1E,3E)-5,5-difluoro-4-methanimidoylpenta-1,3-dienyl]-1,4-diazepane-1-carbaldehyde.
| Compound Name | 4-[(1E,3E)-5,5-difluoro-4-methanimidoylpenta-1,3-dienyl]-1,4-diazepane-1-carbaldehyde |
|---|---|
| PubChem CID | 89473328 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-[(1E,3E)-5,5-difluoro-4-methanimidoylpenta-1,3-dienyl]-1,4-diazepane-1-carbaldehyde |
| SMILES | [H]/N=C/C(=C\C=C\N1CCCN(C=O)CC1)C(F)F |
| InChI | InChI=1S/C12H17F2N3O/c13-12(14)11(9-15)3-1-4-16-5-2-6-17(10-18)8-7-16/h1,3-4,9-10,12,15H,2,5-8H2/b4-1+,11-3+,15-9+ |
| InChIKey | COSNINQLASFAKD-RIPQAKSJSA-N |
| XLogP | 1.51 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|