C22H21IN4O2 — CID 89473517
2-(1,3-benzoxazol-2-ylamino)-10-(2-iodophenyl)-9-methylidene-1,4,5,6,7,10-hexahydro-1,3-diazecin-8-one (PubChem CID 89473517) has the molecular formula C22H21IN4O2 and a molecular weight of 500.34 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-10-(2-iodophenyl)-9-methylidene-1,4,5,6,7,10-hexahydro-1,3-diazecin-8-one.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-10-(2-iodophenyl)-9-methylidene-1,4,5,6,7,10-hexahydro-1,3-diazecin-8-one |
|---|---|
| PubChem CID | 89473517 |
| Molecular Formula | C22H21IN4O2 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-10-(2-iodophenyl)-9-methylidene-1,4,5,6,7,10-hexahydro-1,3-diazecin-8-one |
| SMILES | C=C1C(=O)CCCC/N=C(/Nc2nc3ccccc3o2)NC1c1ccccc1I |
| InChI | InChI=1S/C22H21IN4O2/c1-14-18(28)11-6-7-13-24-21(26-20(14)15-8-2-3-9-16(15)23)27-22-25-17-10-4-5-12-19(17)29-22/h2-5,8-10,12,20H,1,6-7,11,13H2,(H2,24,25,26,27) |
| InChIKey | YNTRYMVCHYCXDG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|