C16H17F2N7O — CID 89473612
1-[(3S,4R)-4-(cyanomethyl)-3-fluoropiperidin-4-yl]-3-[(6-fluoro-3-pyridinyl)amino]pyrazole-4-carboxamide (PubChem CID 89473612) has the molecular formula C16H17F2N7O and a molecular weight of 361.36 g/mol. Its IUPAC name is 1-[(3S,4R)-4-(cyanomethyl)-3-fluoropiperidin-4-yl]-3-[(6-fluoro-3-pyridinyl)amino]pyrazole-4-carboxamide.
| Compound Name | 1-[(3S,4R)-4-(cyanomethyl)-3-fluoropiperidin-4-yl]-3-[(6-fluoro-3-pyridinyl)amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89473612 |
| Molecular Formula | C16H17F2N7O |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-[(3S,4R)-4-(cyanomethyl)-3-fluoropiperidin-4-yl]-3-[(6-fluoro-3-pyridinyl)amino]pyrazole-4-carboxamide |
| SMILES | N#CC[C@]1(n2cc(C(N)=O)c(Nc3ccc(F)nc3)n2)CCNC[C@@H]1F |
| InChI | InChI=1S/C16H17F2N7O/c17-12-8-21-6-4-16(12,3-5-19)25-9-11(14(20)26)15(24-25)23-10-1-2-13(18)22-7-10/h1-2,7,9,12,21H,3-4,6,8H2,(H2,20,26)(H,23,24)/t12-,16-/m0/s1 |
| InChIKey | SOFAMSZXZSMGCD-LRDDRELGSA-N |
| XLogP | 1.20 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|