C13H26N2 — CID 89473882
(Z,4S)-1-N'-(cyclopropylmethyl)-2,4-dimethylhept-5-ene-1,1-diamine (PubChem CID 89473882) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is (Z,4S)-1-N'-(cyclopropylmethyl)-2,4-dimethylhept-5-ene-1,1-diamine.
| Compound Name | (Z,4S)-1-N'-(cyclopropylmethyl)-2,4-dimethylhept-5-ene-1,1-diamine |
|---|---|
| PubChem CID | 89473882 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (Z,4S)-1-N'-(cyclopropylmethyl)-2,4-dimethylhept-5-ene-1,1-diamine |
| SMILES | C/C=C\[C@@H](C)CC(C)C(N)NCC1CC1 |
| InChI | InChI=1S/C13H26N2/c1-4-5-10(2)8-11(3)13(14)15-9-12-6-7-12/h4-5,10-13,15H,6-9,14H2,1-3H3/b5-4-/t10-,11?,13?/m1/s1 |
| InChIKey | VSAHBJFUVUXWBL-BIEKTNBWSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|