About 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine
4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 89473981) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 89473981 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | CC1(C2=CC=C(N)CC2)CCNCC1 |
| InChI | InChI=1S/C12H20N2/c1-12(6-8-14-9-7-12)10-2-4-11(13)5-3-10/h2,4,14H,3,5-9,13H2,1H3 |
| InChIKey | FJTHVAFKJLWVFH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine (CID 89473981) is 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine is CC1(C2=CC=C(N)CC2)CCNCC1.
What is the InChIKey of 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine?
The InChIKey is FJTHVAFKJLWVFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-12(6-8-14-9-7-12)10-2-4-11(13)5-3-10/h2,4,14H,3,5-9,13H2,1H3.
What are the key properties of 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine?
4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine has a molecular weight of 192.31 g/mol, XLogP of 1.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpiperidin-4-yl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89473981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).