About (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine
(1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine (PubChem CID 89473983) has the molecular formula C10H16FN3
and a molecular weight of 197.26 g/mol. Its IUPAC name is (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 89473983 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine |
| SMILES | N[C@@H]1C=C(F)C(N2CCNCC2)=CC1 |
| InChI | InChI=1S/C10H16FN3/c11-9-7-8(12)1-2-10(9)14-5-3-13-4-6-14/h2,7-8,13H,1,3-6,12H2/t8-/m0/s1 |
| InChIKey | SHAPMNCBGRZIKU-QMMMGPOBSA-N |
| XLogP | 0.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
The IUPAC name of (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine (CID 89473983) is (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine is N[C@@H]1C=C(F)C(N2CCNCC2)=CC1.
What is the InChIKey of (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
The InChIKey is SHAPMNCBGRZIKU-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H16FN3/c11-9-7-8(12)1-2-10(9)14-5-3-13-4-6-14/h2,7-8,13H,1,3-6,12H2/t8-/m0/s1.
What are the key properties of (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
(1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine has a molecular weight of 197.26 g/mol, XLogP of 0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3-fluoro-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89473983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).