About (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine
(4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine (PubChem CID 89474041) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine |
| PubChem CID | 89474041 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine |
| SMILES | CNCCC(C)O[C@H]1C=CC(N)=CC1 |
| InChI | InChI=1S/C11H20N2O/c1-9(7-8-13-2)14-11-5-3-10(12)4-6-11/h3-5,9,11,13H,6-8,12H2,1-2H3/t9?,11-/m0/s1 |
| InChIKey | WUGXBEUIDYMYAN-UMJHXOGRSA-N |
| XLogP | 1.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine?
The IUPAC name of (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine (CID 89474041) is (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine?
The canonical SMILES for (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine is CNCCC(C)O[C@H]1C=CC(N)=CC1.
What is the InChIKey of (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine?
The InChIKey is WUGXBEUIDYMYAN-UMJHXOGRSA-N. The full InChI is InChI=1S/C11H20N2O/c1-9(7-8-13-2)14-11-5-3-10(12)4-6-11/h3-5,9,11,13H,6-8,12H2,1-2H3/t9?,11-/m0/s1.
What are the key properties of (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine?
(4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine has a molecular weight of 196.29 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[4-(methylamino)butan-2-yloxy]cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 89474041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).