C33H33ClN6OS — CID 89474116
2-[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)anilino]-6-[2-chloro-4-(2-methyl-1,3-thiazol-5-yl)phenyl]-8-ethylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 89474116) has the molecular formula C33H33ClN6OS and a molecular weight of 597.19 g/mol. Its IUPAC name is 2-[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)anilino]-6-[2-chloro-4-(2-methyl-1,3-thiazol-5-yl)phenyl]-8-ethylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)anilino]-6-[2-chloro-4-(2-methyl-1,3-thiazol-5-yl)phenyl]-8-ethylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 89474116 |
| Molecular Formula | C33H33ClN6OS |
| Molecular Weight | 597.19 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 2-[4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)anilino]-6-[2-chloro-4-(2-methyl-1,3-thiazol-5-yl)phenyl]-8-ethylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cnc(C)s3)cc2Cl)cc2cnc(Nc3ccc(C4CCN5CCCC5C4)cc3)nc21 |
| InChI | InChI=1S/C33H33ClN6OS/c1-3-40-31-24(16-28(32(40)41)27-11-8-23(17-29(27)34)30-19-35-20(2)42-30)18-36-33(38-31)37-25-9-6-21(7-10-25)22-12-14-39-13-4-5-26(39)15-22/h6-11,16-19,22,26H,3-5,12-15H2,1-2H3,(H,36,37,38) |
| InChIKey | HUNDYMWKWAZQKW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.19 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |