C10H15NO — CID 89474162
5,6-dimethyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine (PubChem CID 89474162) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 5,6-dimethyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine.
| Compound Name | 5,6-dimethyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 89474162 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5,6-dimethyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine |
| SMILES | CC1=C2NCCOC2=CCC1C |
| InChI | InChI=1S/C10H15NO/c1-7-3-4-9-10(8(7)2)11-5-6-12-9/h4,7,11H,3,5-6H2,1-2H3 |
| InChIKey | IBELGGDFSPEPFV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |