C11H14FNO2 — CID 89474171
N-[(2E,4E,6E)-7-fluoro-5-prop-1-en-2-yloxyhepta-2,4,6-trien-2-yl]formamide (PubChem CID 89474171) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is N-[(2E,4E,6E)-7-fluoro-5-prop-1-en-2-yloxyhepta-2,4,6-trien-2-yl]formamide.
| Compound Name | N-[(2E,4E,6E)-7-fluoro-5-prop-1-en-2-yloxyhepta-2,4,6-trien-2-yl]formamide |
|---|---|
| PubChem CID | 89474171 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-[(2E,4E,6E)-7-fluoro-5-prop-1-en-2-yloxyhepta-2,4,6-trien-2-yl]formamide |
| SMILES | C=C(C)OC(/C=C/F)=C/C=C(\C)NC=O |
| InChI | InChI=1S/C11H14FNO2/c1-9(2)15-11(6-7-12)5-4-10(3)13-8-14/h4-8H,1H2,2-3H3,(H,13,14)/b7-6+,10-4+,11-5+ |
| InChIKey | WUWQWRIUFMMYBJ-LJLXTZNZSA-N |
| XLogP | 2.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|