C17H21FO2 — CID 89474755
2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-yl 2-methylprop-2-enoate (PubChem CID 89474755) has the molecular formula C17H21FO2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89474755 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(8-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C1CCCc2cccc(F)c21 |
| InChI | InChI=1S/C17H21FO2/c1-11(2)16(19)20-17(3,4)13-9-5-7-12-8-6-10-14(18)15(12)13/h6,8,10,13H,1,5,7,9H2,2-4H3 |
| InChIKey | NECHYIRBJFJJJO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|