About 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole
6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole (PubChem CID 89475054) has the molecular formula C20H11N3S3
and a molecular weight of 389.53 g/mol. Its IUPAC name is 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole |
| PubChem CID | 89475054 |
| Molecular Formula | C20H11N3S3 |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole |
| SMILES | c1nc2ccc(-c3cc4sc(-c5ccc6ncsc6c5)cc4s3)cc2[nH]1 |
| InChI | InChI=1S/C20H11N3S3/c1-3-13-15(22-9-21-13)5-11(1)16-7-19-20(25-16)8-17(26-19)12-2-4-14-18(6-12)24-10-23-14/h1-10H,(H,21,22) |
| InChIKey | LSEWFVICSUGBEP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole?
The IUPAC name of 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole (CID 89475054) is 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole.
What is the SMILES notation for 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole?
The canonical SMILES for 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole is c1nc2ccc(-c3cc4sc(-c5ccc6ncsc6c5)cc4s3)cc2[nH]1.
What is the InChIKey of 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole?
The InChIKey is LSEWFVICSUGBEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11N3S3/c1-3-13-15(22-9-21-13)5-11(1)16-7-19-20(25-16)8-17(26-19)12-2-4-14-18(6-12)24-10-23-14/h1-10H,(H,21,22).
What are the key properties of 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole?
6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole has a molecular weight of 389.53 g/mol, XLogP of 6.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3H-benzimidazol-5-yl)thieno[3,2-b]thiophen-5-yl]-1,3-benzothiazole is sourced from PubChem (CID 89475054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).