About [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate
[1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate (PubChem CID 89475123) has the molecular formula C15H15F3O2
and a molecular weight of 284.28 g/mol. Its IUPAC name is [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate |
| PubChem CID | 89475123 |
| Molecular Formula | C15H15F3O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C)CCc2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C15H15F3O2/c1-9(2)13(19)20-14(3)8-7-10-5-4-6-11(12(10)14)15(16,17)18/h4-6H,1,7-8H2,2-3H3 |
| InChIKey | SLXNBNGVCDUUGI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
The IUPAC name of [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate (CID 89475123) is [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
The canonical SMILES for [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC1(C)CCc2cccc(C(F)(F)F)c21.
What is the InChIKey of [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
The InChIKey is SLXNBNGVCDUUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3O2/c1-9(2)13(19)20-14(3)8-7-10-5-4-6-11(12(10)14)15(16,17)18/h4-6H,1,7-8H2,2-3H3.
What are the key properties of [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
[1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate has a molecular weight of 284.28 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-7-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 89475123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).