About [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate
[1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate (PubChem CID 89475145) has the molecular formula C16H17F3O2
and a molecular weight of 298.30 g/mol. Its IUPAC name is [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate |
| PubChem CID | 89475145 |
| Molecular Formula | C16H17F3O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)CCc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H17F3O2/c1-4-15(21-14(20)10(2)3)8-7-11-9-12(16(17,18)19)5-6-13(11)15/h5-6,9H,2,4,7-8H2,1,3H3 |
| InChIKey | YPGBAGNJPDHWFL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
The IUPAC name of [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate (CID 89475145) is [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
The canonical SMILES for [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC1(CC)CCc2cc(C(F)(F)F)ccc21.
What is the InChIKey of [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
The InChIKey is YPGBAGNJPDHWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3O2/c1-4-15(21-14(20)10(2)3)8-7-11-9-12(16(17,18)19)5-6-13(11)15/h5-6,9H,2,4,7-8H2,1,3H3.
What are the key properties of [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate?
[1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate has a molecular weight of 298.30 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-ethyl-5-(trifluoromethyl)-2,3-dihydroinden-1-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 89475145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).