C16H15FO2 — CID 89475194
(1-ethynyl-5-fluoro-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate (PubChem CID 89475194) has the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. Its IUPAC name is (1-ethynyl-5-fluoro-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate.
| Compound Name | (1-ethynyl-5-fluoro-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89475194 |
| Molecular Formula | C16H15FO2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (1-ethynyl-5-fluoro-3,4-dihydro-2H-naphthalen-1-yl) 2-methylprop-2-enoate |
| SMILES | C#CC1(OC(=O)C(=C)C)CCCc2c(F)cccc21 |
| InChI | InChI=1S/C16H15FO2/c1-4-16(19-15(18)11(2)3)10-6-7-12-13(16)8-5-9-14(12)17/h1,5,8-9H,2,6-7,10H2,3H3 |
| InChIKey | WNFCFBNVIMCTPU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|